C9H11F3N6O2 — CID 174385419
1-amino-1-[3-[amino(carbamoyl)amino]-5-(trifluoromethyl)phenyl]urea (PubChem CID 174385419) has the molecular formula C9H11F3N6O2 and a molecular weight of 292.22 g/mol. Its IUPAC name is 1-amino-1-[3-[amino(carbamoyl)amino]-5-(trifluoromethyl)phenyl]urea.
| Compound Name | 1-amino-1-[3-[amino(carbamoyl)amino]-5-(trifluoromethyl)phenyl]urea |
|---|---|
| PubChem CID | 174385419 |
| Molecular Formula | C9H11F3N6O2 |
| Molecular Weight | 292.22 g/mol |
| Exact Mass | 292.09 |
| IUPAC Name | 1-amino-1-[3-[amino(carbamoyl)amino]-5-(trifluoromethyl)phenyl]urea |
| SMILES | NC(=O)N(N)c1cc(N(N)C(N)=O)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C9H11F3N6O2/c10-9(11,12)4-1-5(17(15)7(13)19)3-6(2-4)18(16)8(14)20/h1-3H,15-16H2,(H2,13,19)(H2,14,20) |
| InChIKey | GQWZQHHVSQMHFA-UHFFFAOYSA-N |
| XLogP | 0.22 |
| TPSA | 144.70 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.22 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|