About N-[3,5-bis(trifluoromethyl)phenyl]-N-methylpropanamide
N-[3,5-bis(trifluoromethyl)phenyl]-N-methylpropanamide (PubChem CID 58356050) has the molecular formula C12H11F6NO
and a molecular weight of 299.21 g/mol. Its IUPAC name is N-[3,5-bis(trifluoromethyl)phenyl]-N-methylpropanamide.
Molecular Properties
| Compound Name | N-[3,5-bis(trifluoromethyl)phenyl]-N-methylpropanamide |
| PubChem CID | 58356050 |
| Molecular Formula | C12H11F6NO |
| Molecular Weight | 299.21 g/mol |
| Exact Mass | 299.07 |
| IUPAC Name | N-[3,5-bis(trifluoromethyl)phenyl]-N-methylpropanamide |
| SMILES | CCC(=O)N(C)c1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C12H11F6NO/c1-3-10(20)19(2)9-5-7(11(13,14)15)4-8(6-9)12(16,17)18/h4-6H,3H2,1-2H3 |
| InChIKey | SZVMANZZKWJYMN-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 299.21 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze N-[3,5-bis(trifluoromethyl)phenyl]-N-methylpropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[3,5-bis(trifluoromethyl)phenyl]-N-methylpropanamide?
The IUPAC name of N-[3,5-bis(trifluoromethyl)phenyl]-N-methylpropanamide (CID 58356050) is N-[3,5-bis(trifluoromethyl)phenyl]-N-methylpropanamide.
What is the SMILES notation for N-[3,5-bis(trifluoromethyl)phenyl]-N-methylpropanamide?
The canonical SMILES for N-[3,5-bis(trifluoromethyl)phenyl]-N-methylpropanamide is CCC(=O)N(C)c1cc(C(F)(F)F)cc(C(F)(F)F)c1.
What is the InChIKey of N-[3,5-bis(trifluoromethyl)phenyl]-N-methylpropanamide?
The InChIKey is SZVMANZZKWJYMN-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H11F6NO/c1-3-10(20)19(2)9-5-7(11(13,14)15)4-8(6-9)12(16,17)18/h4-6H,3H2,1-2H3.
What are the key properties of N-[3,5-bis(trifluoromethyl)phenyl]-N-methylpropanamide?
N-[3,5-bis(trifluoromethyl)phenyl]-N-methylpropanamide has a molecular weight of 299.21 g/mol, XLogP of 4.10, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-[3,5-bis(trifluoromethyl)phenyl]-N-methylpropanamide is sourced from PubChem (CID 58356050), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).