C12H11F6NO — CID 58356050
N-[3,5-bis(trifluoromethyl)phenyl]-N-methylpropanamide (PubChem CID 58356050) has the molecular formula C12H11F6NO and a molecular weight of 299.21 g/mol. Its IUPAC name is N-[3,5-bis(trifluoromethyl)phenyl]-N-methylpropanamide.
| Compound Name | N-[3,5-bis(trifluoromethyl)phenyl]-N-methylpropanamide |
|---|---|
| PubChem CID | 58356050 |
| Molecular Formula | C12H11F6NO |
| Molecular Weight | 299.21 g/mol |
| Exact Mass | 299.07 |
| IUPAC Name | N-[3,5-bis(trifluoromethyl)phenyl]-N-methylpropanamide |
| SMILES | CCC(=O)N(C)c1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C12H11F6NO/c1-3-10(20)19(2)9-5-7(11(13,14)15)4-8(6-9)12(16,17)18/h4-6H,3H2,1-2H3 |
| InChIKey | SZVMANZZKWJYMN-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.21 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |