C12H14F3NO4 — CID 160892589
[3-(dimethoxymethyl)-5-(trifluoromethyl)phenyl]-methylcarbamic acid (PubChem CID 160892589) has the molecular formula C12H14F3NO4 and a molecular weight of 293.24 g/mol. Its IUPAC name is [3-(dimethoxymethyl)-5-(trifluoromethyl)phenyl]-methylcarbamic acid.
| Compound Name | [3-(dimethoxymethyl)-5-(trifluoromethyl)phenyl]-methylcarbamic acid |
|---|---|
| PubChem CID | 160892589 |
| Molecular Formula | C12H14F3NO4 |
| Molecular Weight | 293.24 g/mol |
| Exact Mass | 293.09 |
| IUPAC Name | [3-(dimethoxymethyl)-5-(trifluoromethyl)phenyl]-methylcarbamic acid |
| SMILES | COC(OC)c1cc(N(C)C(=O)O)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C12H14F3NO4/c1-16(11(17)18)9-5-7(10(19-2)20-3)4-8(6-9)12(13,14)15/h4-6,10H,1-3H3,(H,17,18) |
| InChIKey | SOLUJIWEWXFHPO-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.24 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|