C11H9F6NOS — CID 141086010
N-[1-[3,5-bis(trifluoromethyl)phenyl]-2-methylsulfanylethylidene]hydroxylamine (PubChem CID 141086010) has the molecular formula C11H9F6NOS and a molecular weight of 317.25 g/mol. Its IUPAC name is N-[1-[3,5-bis(trifluoromethyl)phenyl]-2-methylsulfanylethylidene]hydroxylamine.
| Compound Name | N-[1-[3,5-bis(trifluoromethyl)phenyl]-2-methylsulfanylethylidene]hydroxylamine |
|---|---|
| PubChem CID | 141086010 |
| Molecular Formula | C11H9F6NOS |
| Molecular Weight | 317.25 g/mol |
| Exact Mass | 317.03 |
| IUPAC Name | N-[1-[3,5-bis(trifluoromethyl)phenyl]-2-methylsulfanylethylidene]hydroxylamine |
| SMILES | CSCC(=NO)c1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C11H9F6NOS/c1-20-5-9(18-19)6-2-7(10(12,13)14)4-8(3-6)11(15,16)17/h2-4,19H,5H2,1H3 |
| InChIKey | INDWVGJXXWGLBR-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.25 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|