C11H8F6O — CID 173058879
1-[3,5-bis(trifluoromethyl)phenyl]prop-1-en-1-ol (PubChem CID 173058879) has the molecular formula C11H8F6O and a molecular weight of 270.17 g/mol. Its IUPAC name is 1-[3,5-bis(trifluoromethyl)phenyl]prop-1-en-1-ol.
| Compound Name | 1-[3,5-bis(trifluoromethyl)phenyl]prop-1-en-1-ol |
|---|---|
| PubChem CID | 173058879 |
| Molecular Formula | C11H8F6O |
| Molecular Weight | 270.17 g/mol |
| Exact Mass | 270.05 |
| IUPAC Name | 1-[3,5-bis(trifluoromethyl)phenyl]prop-1-en-1-ol |
| SMILES | CC=C(O)c1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C11H8F6O/c1-2-9(18)6-3-7(10(12,13)14)5-8(4-6)11(15,16)17/h2-5,18H,1H3 |
| InChIKey | KHPVQUDGPVBVOI-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.17 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|