C15H15F6N — CID 138698803
(Z)-1-[3,5-bis(trifluoromethyl)phenyl]-N,2-dimethylpent-3-en-1-imine (PubChem CID 138698803) has the molecular formula C15H15F6N and a molecular weight of 323.28 g/mol. Its IUPAC name is (Z)-1-[3,5-bis(trifluoromethyl)phenyl]-N,2-dimethylpent-3-en-1-imine.
| Compound Name | (Z)-1-[3,5-bis(trifluoromethyl)phenyl]-N,2-dimethylpent-3-en-1-imine |
|---|---|
| PubChem CID | 138698803 |
| Molecular Formula | C15H15F6N |
| Molecular Weight | 323.28 g/mol |
| Exact Mass | 323.11 |
| IUPAC Name | (Z)-1-[3,5-bis(trifluoromethyl)phenyl]-N,2-dimethylpent-3-en-1-imine |
| SMILES | C/C=C\C(C)/C(=N\C)c1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C15H15F6N/c1-4-5-9(2)13(22-3)10-6-11(14(16,17)18)8-12(7-10)15(19,20)21/h4-9H,1-3H3/b5-4-,22-13+ |
| InChIKey | SCVWBAXDLXFOLJ-QZANSYGUSA-N |
| XLogP | 5.36 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.28 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|