C25H26F7N3O — CID 123557465
2-[[[[1-[3,5-bis(trifluoromethyl)phenyl]-2-methylbutylidene]amino]-ethenylamino]methylidene]-3-(1-fluoroethenyl)hepta-3,5-dienamide (PubChem CID 123557465) has the molecular formula C25H26F7N3O and a molecular weight of 517.49 g/mol. Its IUPAC name is 2-[[[[1-[3,5-bis(trifluoromethyl)phenyl]-2-methylbutylidene]amino]-ethenylamino]methylidene]-3-(1-fluoroethenyl)hepta-3,5-dienamide.
| Compound Name | 2-[[[[1-[3,5-bis(trifluoromethyl)phenyl]-2-methylbutylidene]amino]-ethenylamino]methylidene]-3-(1-fluoroethenyl)hepta-3,5-dienamide |
|---|---|
| PubChem CID | 123557465 |
| Molecular Formula | C25H26F7N3O |
| Molecular Weight | 517.49 g/mol |
| Exact Mass | 517.20 |
| IUPAC Name | 2-[[[[1-[3,5-bis(trifluoromethyl)phenyl]-2-methylbutylidene]amino]-ethenylamino]methylidene]-3-(1-fluoroethenyl)hepta-3,5-dienamide |
| SMILES | C=CN(C=C(C(N)=O)C(=CC=CC)C(=C)F)N=C(c1cc(C(F)(F)F)cc(C(F)(F)F)c1)C(C)CC |
| InChI | InChI=1S/C25H26F7N3O/c1-6-9-10-20(16(5)26)21(23(33)36)14-35(8-3)34-22(15(4)7-2)17-11-18(24(27,28)29)13-19(12-17)25(30,31)32/h6,8-15H,3,5,7H2,1-2,4H3,(H2,33,36) |
| InChIKey | PSTOTDKQXDRHSE-UHFFFAOYSA-N |
| XLogP | 7.27 |
| TPSA | 58.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.49 |
| LogP ≤ 5 | 7.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|