C21H19F6N3O2 — CID 144763489
(Z)-3-[[(E)-1-[3,5-bis(trifluoromethyl)phenyl]ethylideneamino]-[(E)-but-1-enyl]amino]-2-(furan-3-yl)prop-2-enamide (PubChem CID 144763489) has the molecular formula C21H19F6N3O2 and a molecular weight of 459.39 g/mol. Its IUPAC name is (Z)-3-[[(E)-1-[3,5-bis(trifluoromethyl)phenyl]ethylideneamino]-[(E)-but-1-enyl]amino]-2-(furan-3-yl)prop-2-enamide.
| Compound Name | (Z)-3-[[(E)-1-[3,5-bis(trifluoromethyl)phenyl]ethylideneamino]-[(E)-but-1-enyl]amino]-2-(furan-3-yl)prop-2-enamide |
|---|---|
| PubChem CID | 144763489 |
| Molecular Formula | C21H19F6N3O2 |
| Molecular Weight | 459.39 g/mol |
| Exact Mass | 459.14 |
| IUPAC Name | (Z)-3-[[(E)-1-[3,5-bis(trifluoromethyl)phenyl]ethylideneamino]-[(E)-but-1-enyl]amino]-2-(furan-3-yl)prop-2-enamide |
| SMILES | CC/C=C/N(/C=C(\C(N)=O)c1ccoc1)/N=C(\C)c1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C21H19F6N3O2/c1-3-4-6-30(11-18(19(28)31)14-5-7-32-12-14)29-13(2)15-8-16(20(22,23)24)10-17(9-15)21(25,26)27/h4-12H,3H2,1-2H3,(H2,28,31)/b6-4+,18-11-,29-13+ |
| InChIKey | LALPJNCFUHXBEW-OTWFAMLQSA-N |
| XLogP | 5.79 |
| TPSA | 71.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.39 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|