C16H18F3N3O3 — CID 144523491
propan-2-yl (Z)-3-[[(E)-1-[3-hydroxy-5-(trifluoromethyl)phenyl]ethylideneamino]-methanimidoylamino]prop-2-enoate (PubChem CID 144523491) has the molecular formula C16H18F3N3O3 and a molecular weight of 357.33 g/mol. Its IUPAC name is propan-2-yl (Z)-3-[[(E)-1-[3-hydroxy-5-(trifluoromethyl)phenyl]ethylideneamino]-methanimidoylamino]prop-2-enoate.
| Compound Name | propan-2-yl (Z)-3-[[(E)-1-[3-hydroxy-5-(trifluoromethyl)phenyl]ethylideneamino]-methanimidoylamino]prop-2-enoate |
|---|---|
| PubChem CID | 144523491 |
| Molecular Formula | C16H18F3N3O3 |
| Molecular Weight | 357.33 g/mol |
| Exact Mass | 357.13 |
| IUPAC Name | propan-2-yl (Z)-3-[[(E)-1-[3-hydroxy-5-(trifluoromethyl)phenyl]ethylideneamino]-methanimidoylamino]prop-2-enoate |
| SMILES | [H]/N=C/N(/C=C\C(=O)OC(C)C)/N=C(\C)c1cc(O)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C16H18F3N3O3/c1-10(2)25-15(24)4-5-22(9-20)21-11(3)12-6-13(16(17,18)19)8-14(23)7-12/h4-10,20,23H,1-3H3/b5-4-,20-9+,21-11+ |
| InChIKey | MVJHCYGXVGZCAN-AIFIGKHRSA-N |
| XLogP | 3.51 |
| TPSA | 85.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.33 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|