C18H15F6NO2 — CID 89402066
propan-2-yl (Z)-3-[2-[3,5-bis(trifluoromethyl)phenyl]pyrrol-1-yl]prop-2-enoate (PubChem CID 89402066) has the molecular formula C18H15F6NO2 and a molecular weight of 391.31 g/mol. Its IUPAC name is propan-2-yl (Z)-3-[2-[3,5-bis(trifluoromethyl)phenyl]pyrrol-1-yl]prop-2-enoate.
| Compound Name | propan-2-yl (Z)-3-[2-[3,5-bis(trifluoromethyl)phenyl]pyrrol-1-yl]prop-2-enoate |
|---|---|
| PubChem CID | 89402066 |
| Molecular Formula | C18H15F6NO2 |
| Molecular Weight | 391.31 g/mol |
| Exact Mass | 391.10 |
| IUPAC Name | propan-2-yl (Z)-3-[2-[3,5-bis(trifluoromethyl)phenyl]pyrrol-1-yl]prop-2-enoate |
| SMILES | CC(C)OC(=O)/C=C\n1cccc1-c1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C18H15F6NO2/c1-11(2)27-16(26)5-7-25-6-3-4-15(25)12-8-13(17(19,20)21)10-14(9-12)18(22,23)24/h3-11H,1-2H3/b7-5- |
| InChIKey | IEVHNCYTZZHLKH-ALCCZGGFSA-N |
| XLogP | 5.61 |
| TPSA | 31.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.31 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|