C14H19F6N3O2 — CID 171837493
ethane;1-[2-hydroxy-3,5-bis(trifluoromethyl)phenyl]-1-methanimidoylurea (PubChem CID 171837493) has the molecular formula C14H19F6N3O2 and a molecular weight of 375.31 g/mol. Its IUPAC name is ethane;1-[2-hydroxy-3,5-bis(trifluoromethyl)phenyl]-1-methanimidoylurea.
| Compound Name | ethane;1-[2-hydroxy-3,5-bis(trifluoromethyl)phenyl]-1-methanimidoylurea |
|---|---|
| PubChem CID | 171837493 |
| Molecular Formula | C14H19F6N3O2 |
| Molecular Weight | 375.31 g/mol |
| Exact Mass | 375.14 |
| IUPAC Name | ethane;1-[2-hydroxy-3,5-bis(trifluoromethyl)phenyl]-1-methanimidoylurea |
| SMILES | CC.CC.[H]/N=C/N(C(N)=O)c1cc(C(F)(F)F)cc(C(F)(F)F)c1O |
| InChI | InChI=1S/C10H7F6N3O2.2C2H6/c11-9(12,13)4-1-5(10(14,15)16)7(20)6(2-4)19(3-17)8(18)21;2*1-2/h1-3,17,20H,(H2,18,21);2*1-2H3/b17-3+;; |
| InChIKey | GCQYYNMWYBISNO-NTMKYIGOSA-N |
| XLogP | 4.97 |
| TPSA | 90.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.31 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|