C17H22F3N3O3 — CID 134592563
propan-2-yl (Z)-3-[(2Z)-2-[amino-[3-propan-2-yloxy-5-(trifluoromethyl)phenyl]methylidene]hydrazinyl]prop-2-enoate (PubChem CID 134592563) has the molecular formula C17H22F3N3O3 and a molecular weight of 373.38 g/mol. Its IUPAC name is propan-2-yl (Z)-3-[(2Z)-2-[amino-[3-propan-2-yloxy-5-(trifluoromethyl)phenyl]methylidene]hydrazinyl]prop-2-enoate.
| Compound Name | propan-2-yl (Z)-3-[(2Z)-2-[amino-[3-propan-2-yloxy-5-(trifluoromethyl)phenyl]methylidene]hydrazinyl]prop-2-enoate |
|---|---|
| PubChem CID | 134592563 |
| Molecular Formula | C17H22F3N3O3 |
| Molecular Weight | 373.38 g/mol |
| Exact Mass | 373.16 |
| IUPAC Name | propan-2-yl (Z)-3-[(2Z)-2-[amino-[3-propan-2-yloxy-5-(trifluoromethyl)phenyl]methylidene]hydrazinyl]prop-2-enoate |
| SMILES | CC(C)OC(=O)/C=C\N/N=C(\N)c1cc(OC(C)C)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C17H22F3N3O3/c1-10(2)25-14-8-12(7-13(9-14)17(18,19)20)16(21)23-22-6-5-15(24)26-11(3)4/h5-11,22H,1-4H3,(H2,21,23)/b6-5- |
| InChIKey | GCCFJNDWJYPRSL-WAYWQWQTSA-N |
| XLogP | 3.17 |
| TPSA | 85.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.38 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|