C12H9F6NO — CID 99942324
3-[3,5-bis(trifluoromethyl)phenyl]but-3-enamide (PubChem CID 99942324) has the molecular formula C12H9F6NO and a molecular weight of 297.20 g/mol. Its IUPAC name is 3-[3,5-bis(trifluoromethyl)phenyl]but-3-enamide.
| Compound Name | 3-[3,5-bis(trifluoromethyl)phenyl]but-3-enamide |
|---|---|
| PubChem CID | 99942324 |
| Molecular Formula | C12H9F6NO |
| Molecular Weight | 297.20 g/mol |
| Exact Mass | 297.06 |
| IUPAC Name | 3-[3,5-bis(trifluoromethyl)phenyl]but-3-enamide |
| SMILES | C=C(CC(N)=O)c1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C12H9F6NO/c1-6(2-10(19)20)7-3-8(11(13,14)15)5-9(4-7)12(16,17)18/h3-5H,1-2H2,(H2,19,20) |
| InChIKey | IBXYTPKOWMFSGP-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.20 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |