C12H8F6N2O4 — CID 5034926
[2-(carbamoylamino)-2-oxoethyl] 3,5-bis(trifluoromethyl)benzoate (PubChem CID 5034926) has the molecular formula C12H8F6N2O4 and a molecular weight of 358.19 g/mol. Its IUPAC name is [2-(carbamoylamino)-2-oxoethyl] 3,5-bis(trifluoromethyl)benzoate.
| Compound Name | [2-(carbamoylamino)-2-oxoethyl] 3,5-bis(trifluoromethyl)benzoate |
|---|---|
| PubChem CID | 5034926 |
| Molecular Formula | C12H8F6N2O4 |
| Molecular Weight | 358.19 g/mol |
| Exact Mass | 358.04 |
| IUPAC Name | [2-(carbamoylamino)-2-oxoethyl] 3,5-bis(trifluoromethyl)benzoate |
| SMILES | NC(=O)NC(=O)COC(=O)c1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C12H8F6N2O4/c13-11(14,15)6-1-5(2-7(3-6)12(16,17)18)9(22)24-4-8(21)20-10(19)23/h1-3H,4H2,(H3,19,20,21,23) |
| InChIKey | WWADHSCHDHAGEK-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 98.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.19 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |