C10H5F6NO2 — CID 134113339
(2E)-1-[3,5-bis(trifluoromethyl)phenyl]-2-hydroxyiminoethanone (PubChem CID 134113339) has the molecular formula C10H5F6NO2 and a molecular weight of 285.14 g/mol. Its IUPAC name is (2E)-1-[3,5-bis(trifluoromethyl)phenyl]-2-hydroxyiminoethanone.
| Compound Name | (2E)-1-[3,5-bis(trifluoromethyl)phenyl]-2-hydroxyiminoethanone |
|---|---|
| PubChem CID | 134113339 |
| Molecular Formula | C10H5F6NO2 |
| Molecular Weight | 285.14 g/mol |
| Exact Mass | 285.02 |
| IUPAC Name | (2E)-1-[3,5-bis(trifluoromethyl)phenyl]-2-hydroxyiminoethanone |
| SMILES | O=C(/C=N/O)c1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C10H5F6NO2/c11-9(12,13)6-1-5(8(18)4-17-19)2-7(3-6)10(14,15)16/h1-4,19H/b17-4+ |
| InChIKey | OUEIUUWXVPJXKT-HAVNEIBRSA-N |
| XLogP | 3.37 |
| TPSA | 49.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.14 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|