C27H34F3N3O2 — CID 138698936
(E,2E,3E)-2-[[ethenyl-[(E)-[2-methyl-1-[3-methyl-5-(trifluoromethyl)phenyl]butylidene]amino]amino]methylidene]-3-[(ethylideneamino)methylidene]-5-methylhept-4-enoic acid (PubChem CID 138698936) has the molecular formula C27H34F3N3O2 and a molecular weight of 489.58 g/mol. Its IUPAC name is (E,2E,3E)-2-[[ethenyl-[(E)-[2-methyl-1-[3-methyl-5-(trifluoromethyl)phenyl]butylidene]amino]amino]methylidene]-3-[(ethylideneamino)methylidene]-5-methylhept-4-enoic acid.
| Compound Name | (E,2E,3E)-2-[[ethenyl-[(E)-[2-methyl-1-[3-methyl-5-(trifluoromethyl)phenyl]butylidene]amino]amino]methylidene]-3-[(ethylideneamino)methylidene]-5-methylhept-4-enoic acid |
|---|---|
| PubChem CID | 138698936 |
| Molecular Formula | C27H34F3N3O2 |
| Molecular Weight | 489.58 g/mol |
| Exact Mass | 489.26 |
| IUPAC Name | (E,2E,3E)-2-[[ethenyl-[(E)-[2-methyl-1-[3-methyl-5-(trifluoromethyl)phenyl]butylidene]amino]amino]methylidene]-3-[(ethylideneamino)methylidene]-5-methylhept-4-enoic acid |
| SMILES | C=CN(/C=C(C(=O)O)\C(/C=C(\C)CC)=C\N=C\C)/N=C(/c1cc(C)cc(C(F)(F)F)c1)C(C)CC |
| InChI | InChI=1S/C27H34F3N3O2/c1-8-18(5)12-22(16-31-10-3)24(26(34)35)17-33(11-4)32-25(20(7)9-2)21-13-19(6)14-23(15-21)27(28,29)30/h10-17,20H,4,8-9H2,1-3,5-7H3,(H,34,35)/b18-12+,22-16+,24-17+,31-10+,32-25+ |
| InChIKey | IAQMQLJNBNQFJO-KPBUIXQMSA-N |
| XLogP | 7.51 |
| TPSA | 65.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.58 |
| LogP ≤ 5 | 7.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|