C15H17F3 — CID 91562170
1-buta-1,3-dien-2-yl-2-butan-2-yl-4-(trifluoromethyl)benzene (PubChem CID 91562170) has the molecular formula C15H17F3 and a molecular weight of 254.29 g/mol. Its IUPAC name is 1-buta-1,3-dien-2-yl-2-butan-2-yl-4-(trifluoromethyl)benzene.
| Compound Name | 1-buta-1,3-dien-2-yl-2-butan-2-yl-4-(trifluoromethyl)benzene |
|---|---|
| PubChem CID | 91562170 |
| Molecular Formula | C15H17F3 |
| Molecular Weight | 254.29 g/mol |
| Exact Mass | 254.13 |
| IUPAC Name | 1-buta-1,3-dien-2-yl-2-butan-2-yl-4-(trifluoromethyl)benzene |
| SMILES | C=CC(=C)c1ccc(C(F)(F)F)cc1C(C)CC |
| InChI | InChI=1S/C15H17F3/c1-5-10(3)13-8-7-12(15(16,17)18)9-14(13)11(4)6-2/h5,7-9,11H,1,3,6H2,2,4H3 |
| InChIKey | NNFPYXMHWWUPEL-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.29 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|