C27H23F6NO — CID 140983162
N-(1,1-diphenylpent-3-en-2-yl)-N-methyl-3,5-bis(trifluoromethyl)benzamide (PubChem CID 140983162) has the molecular formula C27H23F6NO and a molecular weight of 491.48 g/mol. Its IUPAC name is N-(1,1-diphenylpent-3-en-2-yl)-N-methyl-3,5-bis(trifluoromethyl)benzamide.
| Compound Name | N-(1,1-diphenylpent-3-en-2-yl)-N-methyl-3,5-bis(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 140983162 |
| Molecular Formula | C27H23F6NO |
| Molecular Weight | 491.48 g/mol |
| Exact Mass | 491.17 |
| IUPAC Name | N-(1,1-diphenylpent-3-en-2-yl)-N-methyl-3,5-bis(trifluoromethyl)benzamide |
| SMILES | CC=CC(C(c1ccccc1)c1ccccc1)N(C)C(=O)c1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C27H23F6NO/c1-3-10-23(24(18-11-6-4-7-12-18)19-13-8-5-9-14-19)34(2)25(35)20-15-21(26(28,29)30)17-22(16-20)27(31,32)33/h3-17,23-24H,1-2H3 |
| InChIKey | IWXQYNHHHFBLAU-UHFFFAOYSA-N |
| XLogP | 7.57 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.48 |
| LogP ≤ 5 | 7.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|