C31H27F6N3O2 — CID 142626894
N-[1-(1H-indol-3-yl)-5-oxo-5-(2-phenylethylamino)pent-3-en-2-yl]-N-methyl-3,5-bis(trifluoromethyl)benzamide (PubChem CID 142626894) has the molecular formula C31H27F6N3O2 and a molecular weight of 587.56 g/mol. Its IUPAC name is N-[1-(1H-indol-3-yl)-5-oxo-5-(2-phenylethylamino)pent-3-en-2-yl]-N-methyl-3,5-bis(trifluoromethyl)benzamide.
| Compound Name | N-[1-(1H-indol-3-yl)-5-oxo-5-(2-phenylethylamino)pent-3-en-2-yl]-N-methyl-3,5-bis(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 142626894 |
| Molecular Formula | C31H27F6N3O2 |
| Molecular Weight | 587.56 g/mol |
| Exact Mass | 587.20 |
| IUPAC Name | N-[1-(1H-indol-3-yl)-5-oxo-5-(2-phenylethylamino)pent-3-en-2-yl]-N-methyl-3,5-bis(trifluoromethyl)benzamide |
| SMILES | CN(C(=O)c1cc(C(F)(F)F)cc(C(F)(F)F)c1)C(C=CC(=O)NCCc1ccccc1)Cc1c[nH]c2ccccc12 |
| InChI | InChI=1S/C31H27F6N3O2/c1-40(29(42)21-15-23(30(32,33)34)18-24(16-21)31(35,36)37)25(17-22-19-39-27-10-6-5-9-26(22)27)11-12-28(41)38-14-13-20-7-3-2-4-8-20/h2-12,15-16,18-19,25,39H,13-14,17H2,1H3,(H,38,41) |
| InChIKey | QCCBUKVPXCZKOD-UHFFFAOYSA-N |
| XLogP | 6.80 |
| TPSA | 65.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.56 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|