C21H21F3N2O — CID 24544360
4-(1H-indol-3-yl)-N-[2-[4-(trifluoromethyl)phenyl]ethyl]butanamide (PubChem CID 24544360) has the molecular formula C21H21F3N2O and a molecular weight of 374.41 g/mol. Its IUPAC name is 4-(1H-indol-3-yl)-N-[2-[4-(trifluoromethyl)phenyl]ethyl]butanamide.
| Compound Name | 4-(1H-indol-3-yl)-N-[2-[4-(trifluoromethyl)phenyl]ethyl]butanamide |
|---|---|
| PubChem CID | 24544360 |
| Molecular Formula | C21H21F3N2O |
| Molecular Weight | 374.41 g/mol |
| Exact Mass | 374.16 |
| IUPAC Name | 4-(1H-indol-3-yl)-N-[2-[4-(trifluoromethyl)phenyl]ethyl]butanamide |
| SMILES | O=C(CCCc1c[nH]c2ccccc12)NCCc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C21H21F3N2O/c22-21(23,24)17-10-8-15(9-11-17)12-13-25-20(27)7-3-4-16-14-26-19-6-2-1-5-18(16)19/h1-2,5-6,8-11,14,26H,3-4,7,12-13H2,(H,25,27) |
| InChIKey | FWQRFTQFQNAIGI-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 44.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.41 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |