C19H17ClF3NO — CID 54049845
N-but-2-enyl-2-chloro-2-phenyl-N-[3-(trifluoromethyl)phenyl]acetamide (PubChem CID 54049845) has the molecular formula C19H17ClF3NO and a molecular weight of 367.80 g/mol. Its IUPAC name is N-but-2-enyl-2-chloro-2-phenyl-N-[3-(trifluoromethyl)phenyl]acetamide.
| Compound Name | N-but-2-enyl-2-chloro-2-phenyl-N-[3-(trifluoromethyl)phenyl]acetamide |
|---|---|
| PubChem CID | 54049845 |
| Molecular Formula | C19H17ClF3NO |
| Molecular Weight | 367.80 g/mol |
| Exact Mass | 367.10 |
| IUPAC Name | N-but-2-enyl-2-chloro-2-phenyl-N-[3-(trifluoromethyl)phenyl]acetamide |
| SMILES | CC=CCN(C(=O)C(Cl)c1ccccc1)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C19H17ClF3NO/c1-2-3-12-24(16-11-7-10-15(13-16)19(21,22)23)18(25)17(20)14-8-5-4-6-9-14/h2-11,13,17H,12H2,1H3 |
| InChIKey | LSCRZYXKBBWFPJ-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.80 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|