C12H12ClF3N2S — CID 21480098
1-[(Z)-2-chlorobut-2-enyl]-1-[3-(trifluoromethyl)phenyl]thiourea (PubChem CID 21480098) has the molecular formula C12H12ClF3N2S and a molecular weight of 308.76 g/mol. Its IUPAC name is 1-[(Z)-2-chlorobut-2-enyl]-1-[3-(trifluoromethyl)phenyl]thiourea.
| Compound Name | 1-[(Z)-2-chlorobut-2-enyl]-1-[3-(trifluoromethyl)phenyl]thiourea |
|---|---|
| PubChem CID | 21480098 |
| Molecular Formula | C12H12ClF3N2S |
| Molecular Weight | 308.76 g/mol |
| Exact Mass | 308.04 |
| IUPAC Name | 1-[(Z)-2-chlorobut-2-enyl]-1-[3-(trifluoromethyl)phenyl]thiourea |
| SMILES | C/C=C(\Cl)CN(C(N)=S)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C12H12ClF3N2S/c1-2-9(13)7-18(11(17)19)10-5-3-4-8(6-10)12(14,15)16/h2-6H,7H2,1H3,(H2,17,19)/b9-2- |
| InChIKey | RZYUPBPBGJSAAO-MBXJOHMKSA-N |
| XLogP | 3.90 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.76 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|