C13H11Cl3F3NO — CID 54376750
N-but-2-enyl-2,2,2-trichloro-N-[3-(trifluoromethyl)phenyl]acetamide (PubChem CID 54376750) has the molecular formula C13H11Cl3F3NO and a molecular weight of 360.59 g/mol. Its IUPAC name is N-but-2-enyl-2,2,2-trichloro-N-[3-(trifluoromethyl)phenyl]acetamide.
| Compound Name | N-but-2-enyl-2,2,2-trichloro-N-[3-(trifluoromethyl)phenyl]acetamide |
|---|---|
| PubChem CID | 54376750 |
| Molecular Formula | C13H11Cl3F3NO |
| Molecular Weight | 360.59 g/mol |
| Exact Mass | 358.99 |
| IUPAC Name | N-but-2-enyl-2,2,2-trichloro-N-[3-(trifluoromethyl)phenyl]acetamide |
| SMILES | CC=CCN(C(=O)C(Cl)(Cl)Cl)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C13H11Cl3F3NO/c1-2-3-7-20(11(21)12(14,15)16)10-6-4-5-9(8-10)13(17,18)19/h2-6,8H,7H2,1H3 |
| InChIKey | UXAWEXYGEZCROY-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.59 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|