C13H10F6INO — CID 87496605
N-[(E)-but-2-enyl]-2,2,2-trifluoro-N-[2-iodo-4-(trifluoromethyl)phenyl]acetamide (PubChem CID 87496605) has the molecular formula C13H10F6INO and a molecular weight of 437.12 g/mol. Its IUPAC name is N-[(E)-but-2-enyl]-2,2,2-trifluoro-N-[2-iodo-4-(trifluoromethyl)phenyl]acetamide.
| Compound Name | N-[(E)-but-2-enyl]-2,2,2-trifluoro-N-[2-iodo-4-(trifluoromethyl)phenyl]acetamide |
|---|---|
| PubChem CID | 87496605 |
| Molecular Formula | C13H10F6INO |
| Molecular Weight | 437.12 g/mol |
| Exact Mass | 436.97 |
| IUPAC Name | N-[(E)-but-2-enyl]-2,2,2-trifluoro-N-[2-iodo-4-(trifluoromethyl)phenyl]acetamide |
| SMILES | C/C=C/CN(C(=O)C(F)(F)F)c1ccc(C(F)(F)F)cc1I |
| InChI | InChI=1S/C13H10F6INO/c1-2-3-6-21(11(22)13(17,18)19)10-5-4-8(7-9(10)20)12(14,15)16/h2-5,7H,6H2,1H3/b3-2+ |
| InChIKey | FPZIKHNXTMJMBQ-NSCUHMNNSA-N |
| XLogP | 4.78 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.12 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|