C18H17F3N2S — CID 54473079
1-but-2-enyl-3-phenyl-1-[3-(trifluoromethyl)phenyl]thiourea (PubChem CID 54473079) has the molecular formula C18H17F3N2S and a molecular weight of 350.41 g/mol. Its IUPAC name is 1-but-2-enyl-3-phenyl-1-[3-(trifluoromethyl)phenyl]thiourea.
| Compound Name | 1-but-2-enyl-3-phenyl-1-[3-(trifluoromethyl)phenyl]thiourea |
|---|---|
| PubChem CID | 54473079 |
| Molecular Formula | C18H17F3N2S |
| Molecular Weight | 350.41 g/mol |
| Exact Mass | 350.11 |
| IUPAC Name | 1-but-2-enyl-3-phenyl-1-[3-(trifluoromethyl)phenyl]thiourea |
| SMILES | CC=CCN(C(=S)Nc1ccccc1)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C18H17F3N2S/c1-2-3-12-23(17(24)22-15-9-5-4-6-10-15)16-11-7-8-14(13-16)18(19,20)21/h2-11,13H,12H2,1H3,(H,22,24) |
| InChIKey | XJQVUQMIJNYIPU-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.41 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|