C15H16N2OS — CID 838392
1-(2-hydroxyethyl)-1,3-diphenylthiourea (PubChem CID 838392) has the molecular formula C15H16N2OS and a molecular weight of 272.37 g/mol. Its IUPAC name is 1-(2-hydroxyethyl)-1,3-diphenylthiourea.
| Compound Name | 1-(2-hydroxyethyl)-1,3-diphenylthiourea |
|---|---|
| PubChem CID | 838392 |
| Molecular Formula | C15H16N2OS |
| Molecular Weight | 272.37 g/mol |
| Exact Mass | 272.10 |
| IUPAC Name | 1-(2-hydroxyethyl)-1,3-diphenylthiourea |
| SMILES | OCCN(C(=S)Nc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C15H16N2OS/c18-12-11-17(14-9-5-2-6-10-14)15(19)16-13-7-3-1-4-8-13/h1-10,18H,11-12H2,(H,16,19) |
| InChIKey | JZEHPMQQOOBWJO-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.37 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|