C11H10F3N2O2S- — CID 7312525
3-[N-carbamothioyl-3-(trifluoromethyl)anilino]propanoate (PubChem CID 7312525) has the molecular formula C11H10F3N2O2S- and a molecular weight of 291.27 g/mol. Its IUPAC name is 3-[N-carbamothioyl-3-(trifluoromethyl)anilino]propanoate.
| Compound Name | 3-[N-carbamothioyl-3-(trifluoromethyl)anilino]propanoate |
|---|---|
| PubChem CID | 7312525 |
| Molecular Formula | C11H10F3N2O2S- |
| Molecular Weight | 291.27 g/mol |
| Exact Mass | 291.04 |
| IUPAC Name | 3-[N-carbamothioyl-3-(trifluoromethyl)anilino]propanoate |
| SMILES | NC(=S)N(CCC(=O)[O-])c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C11H11F3N2O2S/c12-11(13,14)7-2-1-3-8(6-7)16(10(15)19)5-4-9(17)18/h1-3,6H,4-5H2,(H2,15,19)(H,17,18)/p-1 |
| InChIKey | GBIFFWFFCAEFNX-UHFFFAOYSA-M |
| XLogP | 0.90 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.27 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|