C12H11Cl2F3N2S — CID 174291312
1-(2,3-dichlorobut-3-en-2-yl)-1-[3-(trifluoromethyl)phenyl]thiourea (PubChem CID 174291312) has the molecular formula C12H11Cl2F3N2S and a molecular weight of 343.20 g/mol. Its IUPAC name is 1-(2,3-dichlorobut-3-en-2-yl)-1-[3-(trifluoromethyl)phenyl]thiourea.
| Compound Name | 1-(2,3-dichlorobut-3-en-2-yl)-1-[3-(trifluoromethyl)phenyl]thiourea |
|---|---|
| PubChem CID | 174291312 |
| Molecular Formula | C12H11Cl2F3N2S |
| Molecular Weight | 343.20 g/mol |
| Exact Mass | 342.00 |
| IUPAC Name | 1-(2,3-dichlorobut-3-en-2-yl)-1-[3-(trifluoromethyl)phenyl]thiourea |
| SMILES | C=C(Cl)C(C)(Cl)N(C(N)=S)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C12H11Cl2F3N2S/c1-7(13)11(2,14)19(10(18)20)9-5-3-4-8(6-9)12(15,16)17/h3-6H,1H2,2H3,(H2,18,20) |
| InChIKey | LWRUVNBKXGQEOV-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.20 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|