C10H12F3NO — CID 117029243
2-[N-methyl-3-(trifluoromethyl)anilino]ethanol (PubChem CID 117029243) has the molecular formula C10H12F3NO and a molecular weight of 219.21 g/mol. Its IUPAC name is 2-[N-methyl-3-(trifluoromethyl)anilino]ethanol.
| Compound Name | 2-[N-methyl-3-(trifluoromethyl)anilino]ethanol |
|---|---|
| PubChem CID | 117029243 |
| Molecular Formula | C10H12F3NO |
| Molecular Weight | 219.21 g/mol |
| Exact Mass | 219.09 |
| IUPAC Name | 2-[N-methyl-3-(trifluoromethyl)anilino]ethanol |
| SMILES | CN(CCO)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C10H12F3NO/c1-14(5-6-15)9-4-2-3-8(7-9)10(11,12)13/h2-4,7,15H,5-6H2,1H3 |
| InChIKey | PIWSRRQJMFUTCN-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.21 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |