C13H16ClF3N2O2 — CID 51927564
(2R)-2-[2-chloro-4-(trifluoromethyl)anilino]-N-methoxy-3-methylbutanamide (PubChem CID 51927564) has the molecular formula C13H16ClF3N2O2 and a molecular weight of 324.73 g/mol. Its IUPAC name is (2R)-2-[2-chloro-4-(trifluoromethyl)anilino]-N-methoxy-3-methylbutanamide.
| Compound Name | (2R)-2-[2-chloro-4-(trifluoromethyl)anilino]-N-methoxy-3-methylbutanamide |
|---|---|
| PubChem CID | 51927564 |
| Molecular Formula | C13H16ClF3N2O2 |
| Molecular Weight | 324.73 g/mol |
| Exact Mass | 324.09 |
| IUPAC Name | (2R)-2-[2-chloro-4-(trifluoromethyl)anilino]-N-methoxy-3-methylbutanamide |
| SMILES | CONC(=O)[C@H](Nc1ccc(C(F)(F)F)cc1Cl)C(C)C |
| InChI | InChI=1S/C13H16ClF3N2O2/c1-7(2)11(12(20)19-21-3)18-10-5-4-8(6-9(10)14)13(15,16)17/h4-7,11,18H,1-3H3,(H,19,20)/t11-/m1/s1 |
| InChIKey | WLEBQHPPBCUMOG-LLVKDONJSA-N |
| XLogP | 3.47 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.73 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|