C17H20ClF3N4O3 — CID 60619145
2-[2-[(2S)-2-[2-chloro-4-(trifluoromethyl)anilino]-3-methylbutanoyl]hydrazinyl]-N-cyclopropyl-2-oxoacetamide (PubChem CID 60619145) has the molecular formula C17H20ClF3N4O3 and a molecular weight of 420.82 g/mol. Its IUPAC name is 2-[2-[(2S)-2-[2-chloro-4-(trifluoromethyl)anilino]-3-methylbutanoyl]hydrazinyl]-N-cyclopropyl-2-oxoacetamide.
| Compound Name | 2-[2-[(2S)-2-[2-chloro-4-(trifluoromethyl)anilino]-3-methylbutanoyl]hydrazinyl]-N-cyclopropyl-2-oxoacetamide |
|---|---|
| PubChem CID | 60619145 |
| Molecular Formula | C17H20ClF3N4O3 |
| Molecular Weight | 420.82 g/mol |
| Exact Mass | 420.12 |
| IUPAC Name | 2-[2-[(2S)-2-[2-chloro-4-(trifluoromethyl)anilino]-3-methylbutanoyl]hydrazinyl]-N-cyclopropyl-2-oxoacetamide |
| SMILES | CC(C)[C@H](Nc1ccc(C(F)(F)F)cc1Cl)C(=O)NNC(=O)C(=O)NC1CC1 |
| InChI | InChI=1S/C17H20ClF3N4O3/c1-8(2)13(14(26)24-25-16(28)15(27)22-10-4-5-10)23-12-6-3-9(7-11(12)18)17(19,20)21/h3,6-8,10,13,23H,4-5H2,1-2H3,(H,22,27)(H,24,26)(H,25,28)/t13-/m0/s1 |
| InChIKey | MZFDRFXONLFBRN-ZDUSSCGKSA-N |
| XLogP | 2.22 |
| TPSA | 99.33 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.82 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|