C21H19ClF3N5O3 — CID 55944718
N'-[(2S)-2-[2-chloro-4-(trifluoromethyl)anilino]-3-methylbutanoyl]-4-oxo-3H-phthalazine-1-carbohydrazide (PubChem CID 55944718) has the molecular formula C21H19ClF3N5O3 and a molecular weight of 481.86 g/mol. Its IUPAC name is N'-[(2S)-2-[2-chloro-4-(trifluoromethyl)anilino]-3-methylbutanoyl]-4-oxo-3H-phthalazine-1-carbohydrazide.
| Compound Name | N'-[(2S)-2-[2-chloro-4-(trifluoromethyl)anilino]-3-methylbutanoyl]-4-oxo-3H-phthalazine-1-carbohydrazide |
|---|---|
| PubChem CID | 55944718 |
| Molecular Formula | C21H19ClF3N5O3 |
| Molecular Weight | 481.86 g/mol |
| Exact Mass | 481.11 |
| IUPAC Name | N'-[(2S)-2-[2-chloro-4-(trifluoromethyl)anilino]-3-methylbutanoyl]-4-oxo-3H-phthalazine-1-carbohydrazide |
| SMILES | CC(C)[C@H](Nc1ccc(C(F)(F)F)cc1Cl)C(=O)NNC(=O)c1n[nH]c(=O)c2ccccc12 |
| InChI | InChI=1S/C21H19ClF3N5O3/c1-10(2)16(26-15-8-7-11(9-14(15)22)21(23,24)25)19(32)29-30-20(33)17-12-5-3-4-6-13(12)18(31)28-27-17/h3-10,16,26H,1-2H3,(H,28,31)(H,29,32)(H,30,33)/t16-/m0/s1 |
| InChIKey | HZPALBAPXFJFHF-INIZCTEOSA-N |
| XLogP | 3.49 |
| TPSA | 115.98 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.86 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|