C17H23ClF3N3O — CID 119388228
2-[2-chloro-4-(trifluoromethyl)anilino]-3-methyl-N-piperidin-4-ylbutanamide (PubChem CID 119388228) has the molecular formula C17H23ClF3N3O and a molecular weight of 377.84 g/mol. Its IUPAC name is 2-[2-chloro-4-(trifluoromethyl)anilino]-3-methyl-N-piperidin-4-ylbutanamide.
| Compound Name | 2-[2-chloro-4-(trifluoromethyl)anilino]-3-methyl-N-piperidin-4-ylbutanamide |
|---|---|
| PubChem CID | 119388228 |
| Molecular Formula | C17H23ClF3N3O |
| Molecular Weight | 377.84 g/mol |
| Exact Mass | 377.15 |
| IUPAC Name | 2-[2-chloro-4-(trifluoromethyl)anilino]-3-methyl-N-piperidin-4-ylbutanamide |
| SMILES | CC(C)C(Nc1ccc(C(F)(F)F)cc1Cl)C(=O)NC1CCNCC1 |
| InChI | InChI=1S/C17H23ClF3N3O/c1-10(2)15(16(25)23-12-5-7-22-8-6-12)24-14-4-3-11(9-13(14)18)17(19,20)21/h3-4,9-10,12,15,22,24H,5-8H2,1-2H3,(H,23,25) |
| InChIKey | SFABJTZQBMCMFT-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 53.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.84 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |