About [(Z)-3-amino-1-[2,6-dichloro-4-(trifluoromethyl)phenoxy]but-2-enyl]azanide
[(Z)-3-amino-1-[2,6-dichloro-4-(trifluoromethyl)phenoxy]but-2-enyl]azanide (PubChem CID 163588218) has the molecular formula C11H10Cl2F3N2O-
and a molecular weight of 314.11 g/mol. Its IUPAC name is [(Z)-3-amino-1-[2,6-dichloro-4-(trifluoromethyl)phenoxy]but-2-enyl]azanide.
Molecular Properties
| Compound Name | [(Z)-3-amino-1-[2,6-dichloro-4-(trifluoromethyl)phenoxy]but-2-enyl]azanide |
| PubChem CID | 163588218 |
| Molecular Formula | C11H10Cl2F3N2O- |
| Molecular Weight | 314.11 g/mol |
| Exact Mass | 313.01 |
| IUPAC Name | [(Z)-3-amino-1-[2,6-dichloro-4-(trifluoromethyl)phenoxy]but-2-enyl]azanide |
| SMILES | C/C(N)=C/C([NH-])Oc1c(Cl)cc(C(F)(F)F)cc1Cl |
| InChI | InChI=1S/C11H10Cl2F3N2O/c1-5(17)2-9(18)19-10-7(12)3-6(4-8(10)13)11(14,15)16/h2-4,9,18H,17H2,1H3/q-1/b5-2- |
| InChIKey | GNHIYCBORIIGCZ-DJWKRKHSSA-N |
| XLogP | 4.63 |
| TPSA | 59.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 314.11 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze [(Z)-3-amino-1-[2,6-dichloro-4-(trifluoromethyl)phenoxy]but-2-enyl]azanide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(Z)-3-amino-1-[2,6-dichloro-4-(trifluoromethyl)phenoxy]but-2-enyl]azanide?
The IUPAC name of [(Z)-3-amino-1-[2,6-dichloro-4-(trifluoromethyl)phenoxy]but-2-enyl]azanide (CID 163588218) is [(Z)-3-amino-1-[2,6-dichloro-4-(trifluoromethyl)phenoxy]but-2-enyl]azanide.
What is the SMILES notation for [(Z)-3-amino-1-[2,6-dichloro-4-(trifluoromethyl)phenoxy]but-2-enyl]azanide?
The canonical SMILES for [(Z)-3-amino-1-[2,6-dichloro-4-(trifluoromethyl)phenoxy]but-2-enyl]azanide is C/C(N)=C/C([NH-])Oc1c(Cl)cc(C(F)(F)F)cc1Cl.
What is the InChIKey of [(Z)-3-amino-1-[2,6-dichloro-4-(trifluoromethyl)phenoxy]but-2-enyl]azanide?
The InChIKey is GNHIYCBORIIGCZ-DJWKRKHSSA-N. The full InChI is InChI=1S/C11H10Cl2F3N2O/c1-5(17)2-9(18)19-10-7(12)3-6(4-8(10)13)11(14,15)16/h2-4,9,18H,17H2,1H3/q-1/b5-2-.
What are the key properties of [(Z)-3-amino-1-[2,6-dichloro-4-(trifluoromethyl)phenoxy]but-2-enyl]azanide?
[(Z)-3-amino-1-[2,6-dichloro-4-(trifluoromethyl)phenoxy]but-2-enyl]azanide has a molecular weight of 314.11 g/mol, XLogP of 4.63, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [(Z)-3-amino-1-[2,6-dichloro-4-(trifluoromethyl)phenoxy]but-2-enyl]azanide is sourced from PubChem (CID 163588218), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).