C10H6Cl3F3N2O — CID 173471874
2-chloro-1-[2,6-dichloro-4-(trifluoromethyl)phenoxy]-3-iminoprop-1-en-1-amine (PubChem CID 173471874) has the molecular formula C10H6Cl3F3N2O and a molecular weight of 333.52 g/mol. Its IUPAC name is 2-chloro-1-[2,6-dichloro-4-(trifluoromethyl)phenoxy]-3-iminoprop-1-en-1-amine.
| Compound Name | 2-chloro-1-[2,6-dichloro-4-(trifluoromethyl)phenoxy]-3-iminoprop-1-en-1-amine |
|---|---|
| PubChem CID | 173471874 |
| Molecular Formula | C10H6Cl3F3N2O |
| Molecular Weight | 333.52 g/mol |
| Exact Mass | 331.95 |
| IUPAC Name | 2-chloro-1-[2,6-dichloro-4-(trifluoromethyl)phenoxy]-3-iminoprop-1-en-1-amine |
| SMILES | [H]/N=C/C(Cl)=C(N)Oc1c(Cl)cc(C(F)(F)F)cc1Cl |
| InChI | InChI=1S/C10H6Cl3F3N2O/c11-5-1-4(10(14,15)16)2-6(12)8(5)19-9(18)7(13)3-17/h1-3,17H,18H2/b9-7?,17-3+ |
| InChIKey | OOBIUFYJWXGXNI-POBXHXLDSA-N |
| XLogP | 4.41 |
| TPSA | 59.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.52 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|