C14H16Cl2F3N3O2 — CID 153099836
1-[(Z)-4-amino-4-[2,6-dichloro-4-(trifluoromethyl)phenoxy]but-2-en-2-yl]-3-ethylurea (PubChem CID 153099836) has the molecular formula C14H16Cl2F3N3O2 and a molecular weight of 386.20 g/mol. Its IUPAC name is 1-[(Z)-4-amino-4-[2,6-dichloro-4-(trifluoromethyl)phenoxy]but-2-en-2-yl]-3-ethylurea.
| Compound Name | 1-[(Z)-4-amino-4-[2,6-dichloro-4-(trifluoromethyl)phenoxy]but-2-en-2-yl]-3-ethylurea |
|---|---|
| PubChem CID | 153099836 |
| Molecular Formula | C14H16Cl2F3N3O2 |
| Molecular Weight | 386.20 g/mol |
| Exact Mass | 385.06 |
| IUPAC Name | 1-[(Z)-4-amino-4-[2,6-dichloro-4-(trifluoromethyl)phenoxy]but-2-en-2-yl]-3-ethylurea |
| SMILES | CCNC(=O)N/C(C)=C\C(N)Oc1c(Cl)cc(C(F)(F)F)cc1Cl |
| InChI | InChI=1S/C14H16Cl2F3N3O2/c1-3-21-13(23)22-7(2)4-11(20)24-12-9(15)5-8(6-10(12)16)14(17,18)19/h4-6,11H,3,20H2,1-2H3,(H2,21,22,23)/b7-4- |
| InChIKey | VQVNMOYWHOZLRB-DAXSKMNVSA-N |
| XLogP | 3.90 |
| TPSA | 76.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.20 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|