C15H19Cl2F3N2 — CID 159253180
N'-[[2,6-dichloro-4-(trifluoromethyl)phenyl]methyl]-N-ethyl-2,2-dimethylpropanimidamide (PubChem CID 159253180) has the molecular formula C15H19Cl2F3N2 and a molecular weight of 355.23 g/mol. Its IUPAC name is N'-[[2,6-dichloro-4-(trifluoromethyl)phenyl]methyl]-N-ethyl-2,2-dimethylpropanimidamide.
| Compound Name | N'-[[2,6-dichloro-4-(trifluoromethyl)phenyl]methyl]-N-ethyl-2,2-dimethylpropanimidamide |
|---|---|
| PubChem CID | 159253180 |
| Molecular Formula | C15H19Cl2F3N2 |
| Molecular Weight | 355.23 g/mol |
| Exact Mass | 354.09 |
| IUPAC Name | N'-[[2,6-dichloro-4-(trifluoromethyl)phenyl]methyl]-N-ethyl-2,2-dimethylpropanimidamide |
| SMILES | CCN/C(=N\Cc1c(Cl)cc(C(F)(F)F)cc1Cl)C(C)(C)C |
| InChI | InChI=1S/C15H19Cl2F3N2/c1-5-21-13(14(2,3)4)22-8-10-11(16)6-9(7-12(10)17)15(18,19)20/h6-7H,5,8H2,1-4H3,(H,21,22) |
| InChIKey | WGEFDQYTRCSCLC-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.23 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|