C10H9Cl3F3NO — CID 168640694
1-chloro-3-[2,6-dichloro-4-(trifluoromethyl)anilino]propan-2-ol (PubChem CID 168640694) has the molecular formula C10H9Cl3F3NO and a molecular weight of 322.54 g/mol. Its IUPAC name is 1-chloro-3-[2,6-dichloro-4-(trifluoromethyl)anilino]propan-2-ol.
| Compound Name | 1-chloro-3-[2,6-dichloro-4-(trifluoromethyl)anilino]propan-2-ol |
|---|---|
| PubChem CID | 168640694 |
| Molecular Formula | C10H9Cl3F3NO |
| Molecular Weight | 322.54 g/mol |
| Exact Mass | 320.97 |
| IUPAC Name | 1-chloro-3-[2,6-dichloro-4-(trifluoromethyl)anilino]propan-2-ol |
| SMILES | OC(CCl)CNc1c(Cl)cc(C(F)(F)F)cc1Cl |
| InChI | InChI=1S/C10H9Cl3F3NO/c11-3-6(18)4-17-9-7(12)1-5(2-8(9)13)10(14,15)16/h1-2,6,17-18H,3-4H2 |
| InChIKey | YIBOFBJNSCNQQM-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.54 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|