C9H9Cl3FNO — CID 168640690
1-chloro-3-(2,3-dichloro-6-fluoroanilino)propan-2-ol (PubChem CID 168640690) has the molecular formula C9H9Cl3FNO and a molecular weight of 272.53 g/mol. Its IUPAC name is 1-chloro-3-(2,3-dichloro-6-fluoroanilino)propan-2-ol.
| Compound Name | 1-chloro-3-(2,3-dichloro-6-fluoroanilino)propan-2-ol |
|---|---|
| PubChem CID | 168640690 |
| Molecular Formula | C9H9Cl3FNO |
| Molecular Weight | 272.53 g/mol |
| Exact Mass | 270.97 |
| IUPAC Name | 1-chloro-3-(2,3-dichloro-6-fluoroanilino)propan-2-ol |
| SMILES | OC(CCl)CNc1c(F)ccc(Cl)c1Cl |
| InChI | InChI=1S/C9H9Cl3FNO/c10-3-5(15)4-14-9-7(13)2-1-6(11)8(9)12/h1-2,5,14-15H,3-4H2 |
| InChIKey | DNIILOYQNKBXHQ-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.53 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|