C11H11Cl3F3NO — CID 168637700
1-chloro-3-[2,3-dichloro-6-methyl-5-(trifluoromethyl)anilino]propan-2-ol (PubChem CID 168637700) has the molecular formula C11H11Cl3F3NO and a molecular weight of 336.57 g/mol. Its IUPAC name is 1-chloro-3-[2,3-dichloro-6-methyl-5-(trifluoromethyl)anilino]propan-2-ol.
| Compound Name | 1-chloro-3-[2,3-dichloro-6-methyl-5-(trifluoromethyl)anilino]propan-2-ol |
|---|---|
| PubChem CID | 168637700 |
| Molecular Formula | C11H11Cl3F3NO |
| Molecular Weight | 336.57 g/mol |
| Exact Mass | 334.99 |
| IUPAC Name | 1-chloro-3-[2,3-dichloro-6-methyl-5-(trifluoromethyl)anilino]propan-2-ol |
| SMILES | Cc1c(C(F)(F)F)cc(Cl)c(Cl)c1NCC(O)CCl |
| InChI | InChI=1S/C11H11Cl3F3NO/c1-5-7(11(15,16)17)2-8(13)9(14)10(5)18-4-6(19)3-12/h2,6,18-19H,3-4H2,1H3 |
| InChIKey | YYDAXUZCHFRPOF-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.57 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|