C9H8BrCl2F2NO — CID 168637029
1-(6-bromo-2-chloro-3,4-difluoroanilino)-3-chloropropan-2-ol (PubChem CID 168637029) has the molecular formula C9H8BrCl2F2NO and a molecular weight of 334.98 g/mol. Its IUPAC name is 1-(6-bromo-2-chloro-3,4-difluoroanilino)-3-chloropropan-2-ol.
| Compound Name | 1-(6-bromo-2-chloro-3,4-difluoroanilino)-3-chloropropan-2-ol |
|---|---|
| PubChem CID | 168637029 |
| Molecular Formula | C9H8BrCl2F2NO |
| Molecular Weight | 334.98 g/mol |
| Exact Mass | 332.91 |
| IUPAC Name | 1-(6-bromo-2-chloro-3,4-difluoroanilino)-3-chloropropan-2-ol |
| SMILES | OC(CCl)CNc1c(Br)cc(F)c(F)c1Cl |
| InChI | InChI=1S/C9H8BrCl2F2NO/c10-5-1-6(13)8(14)7(12)9(5)15-3-4(16)2-11/h1,4,15-16H,2-3H2 |
| InChIKey | CCLNBRBWJNLWDO-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.98 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|