C14H19ClF3N3 — CID 143348045
N-[2-chloro-6-methyl-4-(trifluoromethyl)anilino]-N'-ethyl-2-methylpropanimidamide (PubChem CID 143348045) has the molecular formula C14H19ClF3N3 and a molecular weight of 321.77 g/mol. Its IUPAC name is N-[2-chloro-6-methyl-4-(trifluoromethyl)anilino]-N'-ethyl-2-methylpropanimidamide.
| Compound Name | N-[2-chloro-6-methyl-4-(trifluoromethyl)anilino]-N'-ethyl-2-methylpropanimidamide |
|---|---|
| PubChem CID | 143348045 |
| Molecular Formula | C14H19ClF3N3 |
| Molecular Weight | 321.77 g/mol |
| Exact Mass | 321.12 |
| IUPAC Name | N-[2-chloro-6-methyl-4-(trifluoromethyl)anilino]-N'-ethyl-2-methylpropanimidamide |
| SMILES | CC/N=C(/NNc1c(C)cc(C(F)(F)F)cc1Cl)C(C)C |
| InChI | InChI=1S/C14H19ClF3N3/c1-5-19-13(8(2)3)21-20-12-9(4)6-10(7-11(12)15)14(16,17)18/h6-8,20H,5H2,1-4H3,(H,19,21) |
| InChIKey | JSWBAHVWMXZKBN-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.77 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|