C23H24Cl4F3N3 — CID 102120811
2,2-dichloro-N-[2,6-dichloro-4-(trifluoromethyl)anilino]-1-methyl-N'-(2-phenylethyl)cyclohexane-1-carboximidamide (PubChem CID 102120811) has the molecular formula C23H24Cl4F3N3 and a molecular weight of 541.27 g/mol. Its IUPAC name is 2,2-dichloro-N-[2,6-dichloro-4-(trifluoromethyl)anilino]-1-methyl-N'-(2-phenylethyl)cyclohexane-1-carboximidamide.
| Compound Name | 2,2-dichloro-N-[2,6-dichloro-4-(trifluoromethyl)anilino]-1-methyl-N'-(2-phenylethyl)cyclohexane-1-carboximidamide |
|---|---|
| PubChem CID | 102120811 |
| Molecular Formula | C23H24Cl4F3N3 |
| Molecular Weight | 541.27 g/mol |
| Exact Mass | 539.07 |
| IUPAC Name | 2,2-dichloro-N-[2,6-dichloro-4-(trifluoromethyl)anilino]-1-methyl-N'-(2-phenylethyl)cyclohexane-1-carboximidamide |
| SMILES | CC1(/C(=N/CCc2ccccc2)NNc2c(Cl)cc(C(F)(F)F)cc2Cl)CCCCC1(Cl)Cl |
| InChI | InChI=1S/C23H24Cl4F3N3/c1-21(10-5-6-11-22(21,26)27)20(31-12-9-15-7-3-2-4-8-15)33-32-19-17(24)13-16(14-18(19)25)23(28,29)30/h2-4,7-8,13-14,32H,5-6,9-12H2,1H3,(H,31,33) |
| InChIKey | STFLGLIJQFQUBF-UHFFFAOYSA-N |
| XLogP | 8.32 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.27 |
| LogP ≤ 5 | 8.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|