C12H8Cl5F3N2 — CID 58669717
(1Z)-2,2-dichloro-N-[2,6-dichloro-4-(trifluoromethyl)phenyl]-1-methylcyclopropane-1-carbohydrazonoyl chloride (PubChem CID 58669717) has the molecular formula C12H8Cl5F3N2 and a molecular weight of 414.47 g/mol. Its IUPAC name is (1Z)-2,2-dichloro-N-[2,6-dichloro-4-(trifluoromethyl)phenyl]-1-methylcyclopropane-1-carbohydrazonoyl chloride.
| Compound Name | (1Z)-2,2-dichloro-N-[2,6-dichloro-4-(trifluoromethyl)phenyl]-1-methylcyclopropane-1-carbohydrazonoyl chloride |
|---|---|
| PubChem CID | 58669717 |
| Molecular Formula | C12H8Cl5F3N2 |
| Molecular Weight | 414.47 g/mol |
| Exact Mass | 411.91 |
| IUPAC Name | (1Z)-2,2-dichloro-N-[2,6-dichloro-4-(trifluoromethyl)phenyl]-1-methylcyclopropane-1-carbohydrazonoyl chloride |
| SMILES | CC1(/C(Cl)=N/Nc2c(Cl)cc(C(F)(F)F)cc2Cl)CC1(Cl)Cl |
| InChI | InChI=1S/C12H8Cl5F3N2/c1-10(4-11(10,16)17)9(15)22-21-8-6(13)2-5(3-7(8)14)12(18,19)20/h2-3,21H,4H2,1H3/b22-9- |
| InChIKey | WJNCEBXKBMKPDM-AFPJDJCSSA-N |
| XLogP | 6.56 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.47 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|