C14H14Cl2F3N3O3 — CID 162549236
1-[(Z)-4-amino-4-[2,6-dichloro-4-(trifluoromethyl)phenoxy]but-2-en-2-yl]-3-(2-oxoethyl)urea (PubChem CID 162549236) has the molecular formula C14H14Cl2F3N3O3 and a molecular weight of 400.18 g/mol. Its IUPAC name is 1-[(Z)-4-amino-4-[2,6-dichloro-4-(trifluoromethyl)phenoxy]but-2-en-2-yl]-3-(2-oxoethyl)urea.
| Compound Name | 1-[(Z)-4-amino-4-[2,6-dichloro-4-(trifluoromethyl)phenoxy]but-2-en-2-yl]-3-(2-oxoethyl)urea |
|---|---|
| PubChem CID | 162549236 |
| Molecular Formula | C14H14Cl2F3N3O3 |
| Molecular Weight | 400.18 g/mol |
| Exact Mass | 399.04 |
| IUPAC Name | 1-[(Z)-4-amino-4-[2,6-dichloro-4-(trifluoromethyl)phenoxy]but-2-en-2-yl]-3-(2-oxoethyl)urea |
| SMILES | C/C(=C/C(N)Oc1c(Cl)cc(C(F)(F)F)cc1Cl)NC(=O)NCC=O |
| InChI | InChI=1S/C14H14Cl2F3N3O3/c1-7(22-13(24)21-2-3-23)4-11(20)25-12-9(15)5-8(6-10(12)16)14(17,18)19/h3-6,11H,2,20H2,1H3,(H2,21,22,24)/b7-4- |
| InChIKey | RBNGSTKJVQBCAX-DAXSKMNVSA-N |
| XLogP | 3.08 |
| TPSA | 93.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.18 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|