C9H7Cl2F3O3S — CID 18338302
ethyl 2,6-dichloro-4-(trifluoromethyl)benzenesulfonate (PubChem CID 18338302) has the molecular formula C9H7Cl2F3O3S and a molecular weight of 323.12 g/mol. Its IUPAC name is ethyl 2,6-dichloro-4-(trifluoromethyl)benzenesulfonate.
| Compound Name | ethyl 2,6-dichloro-4-(trifluoromethyl)benzenesulfonate |
|---|---|
| PubChem CID | 18338302 |
| Molecular Formula | C9H7Cl2F3O3S |
| Molecular Weight | 323.12 g/mol |
| Exact Mass | 321.94 |
| IUPAC Name | ethyl 2,6-dichloro-4-(trifluoromethyl)benzenesulfonate |
| SMILES | CCOS(=O)(=O)c1c(Cl)cc(C(F)(F)F)cc1Cl |
| InChI | InChI=1S/C9H7Cl2F3O3S/c1-2-17-18(15,16)8-6(10)3-5(4-7(8)11)9(12,13)14/h3-4H,2H2,1H3 |
| InChIKey | ABODHERXHHITAU-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.12 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|