C13H9Cl2F3O2 — CID 170472079
ethyl 4-[2,6-dichloro-4-(trifluoromethyl)phenyl]but-3-ynoate (PubChem CID 170472079) has the molecular formula C13H9Cl2F3O2 and a molecular weight of 325.11 g/mol. Its IUPAC name is ethyl 4-[2,6-dichloro-4-(trifluoromethyl)phenyl]but-3-ynoate.
| Compound Name | ethyl 4-[2,6-dichloro-4-(trifluoromethyl)phenyl]but-3-ynoate |
|---|---|
| PubChem CID | 170472079 |
| Molecular Formula | C13H9Cl2F3O2 |
| Molecular Weight | 325.11 g/mol |
| Exact Mass | 323.99 |
| IUPAC Name | ethyl 4-[2,6-dichloro-4-(trifluoromethyl)phenyl]but-3-ynoate |
| SMILES | CCOC(=O)CC#Cc1c(Cl)cc(C(F)(F)F)cc1Cl |
| InChI | InChI=1S/C13H9Cl2F3O2/c1-2-20-12(19)5-3-4-9-10(14)6-8(7-11(9)15)13(16,17)18/h6-7H,2,5H2,1H3 |
| InChIKey | LAEPYRGXFMVEME-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.11 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|