C11H11Cl2F3N2O4S — CID 174832456
2,6-dichloro-4-(trifluoromethyl)aniline;ethyl 2-(sulfonylamino)acetate (PubChem CID 174832456) has the molecular formula C11H11Cl2F3N2O4S and a molecular weight of 395.19 g/mol. Its IUPAC name is 2,6-dichloro-4-(trifluoromethyl)aniline;ethyl 2-(sulfonylamino)acetate.
| Compound Name | 2,6-dichloro-4-(trifluoromethyl)aniline;ethyl 2-(sulfonylamino)acetate |
|---|---|
| PubChem CID | 174832456 |
| Molecular Formula | C11H11Cl2F3N2O4S |
| Molecular Weight | 395.19 g/mol |
| Exact Mass | 393.98 |
| IUPAC Name | 2,6-dichloro-4-(trifluoromethyl)aniline;ethyl 2-(sulfonylamino)acetate |
| SMILES | CCOC(=O)CN=S(=O)=O.Nc1c(Cl)cc(C(F)(F)F)cc1Cl |
| InChI | InChI=1S/C7H4Cl2F3N.C4H7NO4S/c8-4-1-3(7(10,11)12)2-5(9)6(4)13;1-2-9-4(6)3-5-10(7)8/h1-2H,13H2;2-3H2,1H3 |
| InChIKey | ZQBQVEGVIUUGSM-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 98.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.19 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|