C13H9F4N3O — CID 136836653
2-[(Z)-C-methyl-N-[(2,3,5,6-tetrafluoro-4-pyridinyl)amino]carbonimidoyl]phenol (PubChem CID 136836653) has the molecular formula C13H9F4N3O and a molecular weight of 299.23 g/mol. Its IUPAC name is 2-[(Z)-C-methyl-N-[(2,3,5,6-tetrafluoro-4-pyridinyl)amino]carbonimidoyl]phenol.
| Compound Name | 2-[(Z)-C-methyl-N-[(2,3,5,6-tetrafluoro-4-pyridinyl)amino]carbonimidoyl]phenol |
|---|---|
| PubChem CID | 136836653 |
| Molecular Formula | C13H9F4N3O |
| Molecular Weight | 299.23 g/mol |
| Exact Mass | 299.07 |
| IUPAC Name | 2-[(Z)-C-methyl-N-[(2,3,5,6-tetrafluoro-4-pyridinyl)amino]carbonimidoyl]phenol |
| SMILES | C/C(=N/Nc1c(F)c(F)nc(F)c1F)c1ccccc1O |
| InChI | InChI=1S/C13H9F4N3O/c1-6(7-4-2-3-5-8(7)21)19-20-11-9(14)12(16)18-13(17)10(11)15/h2-5,21H,1H3,(H,18,20)/b19-6- |
| InChIKey | BTPSZHXWTHCSAU-SWNXQHNESA-N |
| XLogP | 3.18 |
| TPSA | 57.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.23 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|