C19H25N7O — CID 3787858
2-[N-[(4,6-dipyrrolidin-1-yl-1,3,5-triazin-2-yl)amino]-C-methylcarbonimidoyl]phenol (PubChem CID 3787858) has the molecular formula C19H25N7O and a molecular weight of 367.46 g/mol. Its IUPAC name is 2-[N-[(4,6-dipyrrolidin-1-yl-1,3,5-triazin-2-yl)amino]-C-methylcarbonimidoyl]phenol.
| Compound Name | 2-[N-[(4,6-dipyrrolidin-1-yl-1,3,5-triazin-2-yl)amino]-C-methylcarbonimidoyl]phenol |
|---|---|
| PubChem CID | 3787858 |
| Molecular Formula | C19H25N7O |
| Molecular Weight | 367.46 g/mol |
| Exact Mass | 367.21 |
| IUPAC Name | 2-[N-[(4,6-dipyrrolidin-1-yl-1,3,5-triazin-2-yl)amino]-C-methylcarbonimidoyl]phenol |
| SMILES | CC(=NNc1nc(N2CCCC2)nc(N2CCCC2)n1)c1ccccc1O |
| InChI | InChI=1S/C19H25N7O/c1-14(15-8-2-3-9-16(15)27)23-24-17-20-18(25-10-4-5-11-25)22-19(21-17)26-12-6-7-13-26/h2-3,8-9,27H,4-7,10-13H2,1H3,(H,20,21,22,24) |
| InChIKey | BIRBDGAUQGZVDJ-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 89.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.46 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|